C18H24F2N2O7 — CID 90360402
(2R,3S,5R)-5-acetamido-4-(benzylamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 90360402) has the molecular formula C18H24F2N2O7 and a molecular weight of 418.39 g/mol. Its IUPAC name is (2R,3S,5R)-5-acetamido-4-(benzylamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,3S,5R)-5-acetamido-4-(benzylamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90360402 |
| Molecular Formula | C18H24F2N2O7 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R,3S,5R)-5-acetamido-4-(benzylamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](F)(C(=O)O)[C@@H](F)C1NCc1ccccc1 |
| InChI | InChI=1S/C18H24F2N2O7/c1-9(24)22-12-13(21-7-10-5-3-2-4-6-10)16(19)18(20,17(27)28)29-15(12)14(26)11(25)8-23/h2-6,11-16,21,23,25-26H,7-8H2,1H3,(H,22,24)(H,27,28)/t11-,12-,13?,14-,15?,16+,18-/m1/s1 |
| InChIKey | TXMYZXLAFQJRDT-IFBRTUOASA-N |
| XLogP | -1.15 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |