About 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol
2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol (PubChem CID 90360547) has the molecular formula C19H40O4
and a molecular weight of 332.53 g/mol. Its IUPAC name is 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol |
| PubChem CID | 90360547 |
| Molecular Formula | C19H40O4 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol |
| SMILES | CCC(C)(C)COC(C)(C)COC(C)(C)CCOC(C)(C)CO |
| InChI | InChI=1S/C19H40O4/c1-10-16(2,3)14-22-19(8,9)15-23-17(4,5)11-12-21-18(6,7)13-20/h20H,10-15H2,1-9H3 |
| InChIKey | NECFCCUXORGMNP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol?
The IUPAC name of 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol (CID 90360547) is 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol.
What is the SMILES notation for 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol?
The canonical SMILES for 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol is CCC(C)(C)COC(C)(C)COC(C)(C)CCOC(C)(C)CO.
What is the InChIKey of 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol?
The InChIKey is NECFCCUXORGMNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O4/c1-10-16(2,3)14-22-19(8,9)15-23-17(4,5)11-12-21-18(6,7)13-20/h20H,10-15H2,1-9H3.
What are the key properties of 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol?
2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol has a molecular weight of 332.53 g/mol, XLogP of 4.19, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(2,2-dimethylbutoxy)-2-methylpropoxy]-3-methylbutoxy]-2-methylpropan-1-ol is sourced from PubChem (CID 90360547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).