About 9a-iodo-4a,9-dihydrocarbazole
9a-iodo-4a,9-dihydrocarbazole (PubChem CID 90360677) has the molecular formula C12H10IN
and a molecular weight of 295.12 g/mol. Its IUPAC name is 9a-iodo-4a,9-dihydrocarbazole.
Molecular Properties
| Compound Name | 9a-iodo-4a,9-dihydrocarbazole |
| PubChem CID | 90360677 |
| Molecular Formula | C12H10IN |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 9a-iodo-4a,9-dihydrocarbazole |
| SMILES | IC12C=CC=CC1c1ccccc1N2 |
| InChI | InChI=1S/C12H10IN/c13-12-8-4-3-6-10(12)9-5-1-2-7-11(9)14-12/h1-8,10,14H |
| InChIKey | MYXQVIVIEQPKQU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 9a-iodo-4a,9-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9a-iodo-4a,9-dihydrocarbazole?
The IUPAC name of 9a-iodo-4a,9-dihydrocarbazole (CID 90360677) is 9a-iodo-4a,9-dihydrocarbazole.
What is the SMILES notation for 9a-iodo-4a,9-dihydrocarbazole?
The canonical SMILES for 9a-iodo-4a,9-dihydrocarbazole is IC12C=CC=CC1c1ccccc1N2.
What is the InChIKey of 9a-iodo-4a,9-dihydrocarbazole?
The InChIKey is MYXQVIVIEQPKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10IN/c13-12-8-4-3-6-10(12)9-5-1-2-7-11(9)14-12/h1-8,10,14H.
What are the key properties of 9a-iodo-4a,9-dihydrocarbazole?
9a-iodo-4a,9-dihydrocarbazole has a molecular weight of 295.12 g/mol, XLogP of 3.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9a-iodo-4a,9-dihydrocarbazole is sourced from PubChem (CID 90360677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).