About 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine
1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine (PubChem CID 90360688) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine.
Molecular Properties
| Compound Name | 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine |
| PubChem CID | 90360688 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine |
| SMILES | C=CCCCN(C)/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C13H27N3/c1-7-8-9-10-16(6)13(14-11(2)3)15-12(4)5/h7,11-12H,1,8-10H2,2-6H3,(H,14,15) |
| InChIKey | ZDHIFBUCAIWGLA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine?
The IUPAC name of 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine (CID 90360688) is 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine.
What is the SMILES notation for 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine?
The canonical SMILES for 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine is C=CCCCN(C)/C(=N\C(C)C)NC(C)C.
What is the InChIKey of 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine?
The InChIKey is ZDHIFBUCAIWGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3/c1-7-8-9-10-16(6)13(14-11(2)3)15-12(4)5/h7,11-12H,1,8-10H2,2-6H3,(H,14,15).
What are the key properties of 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine?
1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine has a molecular weight of 225.38 g/mol, XLogP of 2.65, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-pent-4-enyl-2,3-di(propan-2-yl)guanidine is sourced from PubChem (CID 90360688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).