C23H32N6O2S — CID 90360800
(5S)-5-[[2-[4-[(2Z,4Z)-1-iminohexa-2,4-dien-3-yl]piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-1-methylpiperidin-2-one (PubChem CID 90360800) has the molecular formula C23H32N6O2S and a molecular weight of 456.62 g/mol. Its IUPAC name is (5S)-5-[[2-[4-[(2Z,4Z)-1-iminohexa-2,4-dien-3-yl]piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-1-methylpiperidin-2-one.
| Compound Name | (5S)-5-[[2-[4-[(2Z,4Z)-1-iminohexa-2,4-dien-3-yl]piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 90360800 |
| Molecular Formula | C23H32N6O2S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (5S)-5-[[2-[4-[(2Z,4Z)-1-iminohexa-2,4-dien-3-yl]piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]-1-methylpiperidin-2-one |
| SMILES | [H]/N=C/C=C(\C=C/C)C1CCN(c2nc3c(c(N[C@H]4CCC(=O)N(C)C4)n2)S(=O)CC3)CC1 |
| InChI | InChI=1S/C23H32N6O2S/c1-3-4-16(7-11-24)17-8-12-29(13-9-17)23-26-19-10-14-32(31)21(19)22(27-23)25-18-5-6-20(30)28(2)15-18/h3-4,7,11,17-18,24H,5-6,8-10,12-15H2,1-2H3,(H,25,26,27)/b4-3-,16-7+,24-11+/t18-,32?/m0/s1 |
| InChIKey | JTRJCBAEDSAAAR-VMXYQXOTSA-N |
| XLogP | 2.54 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|