C24H31N5O4S — CID 90360842
methyl 3-[1-[4-[amino(oxan-4-yl)amino]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]benzoate (PubChem CID 90360842) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is methyl 3-[1-[4-[amino(oxan-4-yl)amino]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]benzoate.
| Compound Name | methyl 3-[1-[4-[amino(oxan-4-yl)amino]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]benzoate |
|---|---|
| PubChem CID | 90360842 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | methyl 3-[1-[4-[amino(oxan-4-yl)amino]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]benzoate |
| SMILES | COC(=O)c1cccc(C2CCN(c3nc4c(c(N(N)C5CCOCC5)n3)S(=O)CC4)CC2)c1 |
| InChI | InChI=1S/C24H31N5O4S/c1-32-23(30)18-4-2-3-17(15-18)16-5-10-28(11-6-16)24-26-20-9-14-34(31)21(20)22(27-24)29(25)19-7-12-33-13-8-19/h2-4,15-16,19H,5-14,25H2,1H3 |
| InChIKey | LIGIJNPKODFRDQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|