C28H36FN5O4S — CID 90360908
2-fluoro-1-[7-[1-[4-(oxan-4-ylamino)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]oxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethanone (PubChem CID 90360908) has the molecular formula C28H36FN5O4S and a molecular weight of 557.69 g/mol. Its IUPAC name is 2-fluoro-1-[7-[1-[4-(oxan-4-ylamino)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]oxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethanone.
| Compound Name | 2-fluoro-1-[7-[1-[4-(oxan-4-ylamino)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]oxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethanone |
|---|---|
| PubChem CID | 90360908 |
| Molecular Formula | C28H36FN5O4S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-fluoro-1-[7-[1-[4-(oxan-4-ylamino)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-2-yl]piperidin-4-yl]oxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl]ethanone |
| SMILES | O=C(CF)N1CCc2ccc(OC3CCN(c4nc5c(c(NC6CCOCC6)n4)S(=O)CC5)CC3)cc2CC1 |
| InChI | InChI=1S/C28H36FN5O4S/c29-18-25(35)33-10-3-19-1-2-23(17-20(19)4-11-33)38-22-5-12-34(13-6-22)28-31-24-9-16-39(36)26(24)27(32-28)30-21-7-14-37-15-8-21/h1-2,17,21-22H,3-16,18H2,(H,30,31,32) |
| InChIKey | AVXRFOWRMMXCCJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |