C30H46B2O4S2 — CID 90361915
4,4,5,5-tetramethyl-2-[7-methyl-7-octyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1,3,2-dioxaborolane (PubChem CID 90361915) has the molecular formula C30H46B2O4S2 and a molecular weight of 556.45 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[7-methyl-7-octyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[7-methyl-7-octyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90361915 |
| Molecular Formula | C30H46B2O4S2 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[7-methyl-7-octyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)sc2-c2sc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C30H46B2O4S2/c1-11-12-13-14-15-16-17-30(10)20-18-22(31-33-26(2,3)27(4,5)34-31)37-24(20)25-21(30)19-23(38-25)32-35-28(6,7)29(8,9)36-32/h18-19H,11-17H2,1-10H3 |
| InChIKey | GRJZGITXTZIBGT-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|