About 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate
2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate (PubChem CID 90362172) has the molecular formula C19H40O3Si2
and a molecular weight of 372.70 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate |
| PubChem CID | 90362172 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate |
| SMILES | CCC/C=C/[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-10-11-12-13-17(22-24(8,9)19(2,3)4)16-18(20)21-14-15-23(5,6)7/h12-13,17H,10-11,14-16H2,1-9H3/b13-12+/t17-/m1/s1 |
| InChIKey | NGHSLJIZAKRFNR-GZKZCVOOSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate?
The IUPAC name of 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate (CID 90362172) is 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate.
What is the SMILES notation for 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate?
The canonical SMILES for 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate is CCC/C=C/[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate?
The InChIKey is NGHSLJIZAKRFNR-GZKZCVOOSA-N. The full InChI is InChI=1S/C19H40O3Si2/c1-10-11-12-13-17(22-24(8,9)19(2,3)4)16-18(20)21-14-15-23(5,6)7/h12-13,17H,10-11,14-16H2,1-9H3/b13-12+/t17-/m1/s1.
What are the key properties of 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate?
2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate has a molecular weight of 372.70 g/mol, XLogP of 6.00, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-4-enoate is sourced from PubChem (CID 90362172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).