C16H25IO2 — CID 90362220
methyl (1S,4aR,8aS)-6-iodo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carboxylate (PubChem CID 90362220) has the molecular formula C16H25IO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is methyl (1S,4aR,8aS)-6-iodo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,8aS)-6-iodo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 90362220 |
| Molecular Formula | C16H25IO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl (1S,4aR,8aS)-6-iodo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@H]2C(C)(C)C(I)CC[C@]2(C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C16H25IO2/c1-10-6-7-11-15(2,3)12(17)8-9-16(11,4)13(10)14(18)19-5/h11-13H,1,6-9H2,2-5H3/t11-,12?,13+,16-/m0/s1 |
| InChIKey | FSUZKFMSRVMQRN-OWYBYSJYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|