C11H21BrO3 — CID 90362238
(2S,4S,5R,8S)-8-[(1R)-1-bromopropyl]-2-methyloxocane-4,5-diol (PubChem CID 90362238) has the molecular formula C11H21BrO3 and a molecular weight of 281.19 g/mol. Its IUPAC name is (2S,4S,5R,8S)-8-[(1R)-1-bromopropyl]-2-methyloxocane-4,5-diol.
| Compound Name | (2S,4S,5R,8S)-8-[(1R)-1-bromopropyl]-2-methyloxocane-4,5-diol |
|---|---|
| PubChem CID | 90362238 |
| Molecular Formula | C11H21BrO3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2S,4S,5R,8S)-8-[(1R)-1-bromopropyl]-2-methyloxocane-4,5-diol |
| SMILES | CC[C@@H](Br)[C@@H]1CC[C@@H](O)[C@@H](O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H21BrO3/c1-3-8(12)11-5-4-9(13)10(14)6-7(2)15-11/h7-11,13-14H,3-6H2,1-2H3/t7-,8+,9+,10-,11-/m0/s1 |
| InChIKey | DHWQNCRQGKXVED-GEVSDDDWSA-N |
| XLogP | 1.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|