C12H22O — CID 90362246
(2S,3S,5R)-2-[(Z)-hex-3-enyl]-3,5-dimethyloxolane (PubChem CID 90362246) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (2S,3S,5R)-2-[(Z)-hex-3-enyl]-3,5-dimethyloxolane.
| Compound Name | (2S,3S,5R)-2-[(Z)-hex-3-enyl]-3,5-dimethyloxolane |
|---|---|
| PubChem CID | 90362246 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (2S,3S,5R)-2-[(Z)-hex-3-enyl]-3,5-dimethyloxolane |
| SMILES | CC/C=C\CC[C@@H]1O[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C12H22O/c1-4-5-6-7-8-12-10(2)9-11(3)13-12/h5-6,10-12H,4,7-9H2,1-3H3/b6-5-/t10-,11+,12-/m0/s1 |
| InChIKey | GYZLZPJNFNGEJW-AKVLOFAVSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|