C11H20O — CID 90362250
(2S,3S,5R)-3,5-dimethyl-2-[(E)-pent-2-enyl]oxolane (PubChem CID 90362250) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2S,3S,5R)-3,5-dimethyl-2-[(E)-pent-2-enyl]oxolane.
| Compound Name | (2S,3S,5R)-3,5-dimethyl-2-[(E)-pent-2-enyl]oxolane |
|---|---|
| PubChem CID | 90362250 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2S,3S,5R)-3,5-dimethyl-2-[(E)-pent-2-enyl]oxolane |
| SMILES | CC/C=C/C[C@@H]1O[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C11H20O/c1-4-5-6-7-11-9(2)8-10(3)12-11/h5-6,9-11H,4,7-8H2,1-3H3/b6-5+/t9-,10+,11-/m0/s1 |
| InChIKey | ORQRELAYUXAILJ-VJZJGBKASA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|