C17H23I — CID 90362304
(2S,10aR)-2-iodo-1,1,6-trimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene (PubChem CID 90362304) has the molecular formula C17H23I and a molecular weight of 354.28 g/mol. Its IUPAC name is (2S,10aR)-2-iodo-1,1,6-trimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene.
| Compound Name | (2S,10aR)-2-iodo-1,1,6-trimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene |
|---|---|
| PubChem CID | 90362304 |
| Molecular Formula | C17H23I |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (2S,10aR)-2-iodo-1,1,6-trimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene |
| SMILES | Cc1ccc2c(c1)C1CC[C@H](I)C(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C17H23I/c1-11-4-5-12-6-8-15-13(14(12)10-11)7-9-16(18)17(15,2)3/h4-5,10,13,15-16H,6-9H2,1-3H3/t13?,15-,16+/m1/s1 |
| InChIKey | PFINOGMCYPBGHO-CZVYVAOFSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|