C21H33BrO2 — CID 90362319
methyl (2E,6E)-9-[(5S)-5-bromo-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,6-dienoate (PubChem CID 90362319) has the molecular formula C21H33BrO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is methyl (2E,6E)-9-[(5S)-5-bromo-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,6-dienoate.
| Compound Name | methyl (2E,6E)-9-[(5S)-5-bromo-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,6-dienoate |
|---|---|
| PubChem CID | 90362319 |
| Molecular Formula | C21H33BrO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl (2E,6E)-9-[(5S)-5-bromo-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,6-dienoate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CCC1=C(C)CC[C@H](Br)C1(C)C |
| InChI | InChI=1S/C21H33BrO2/c1-15(8-7-9-16(2)14-20(23)24-6)10-12-18-17(3)11-13-19(22)21(18,4)5/h8,14,19H,7,9-13H2,1-6H3/b15-8+,16-14+/t19-/m0/s1 |
| InChIKey | TVLUOGPFESTPOK-YSYLFGTNSA-N |
| XLogP | 6.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|