About methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate
methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate (PubChem CID 90362386) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate |
| PubChem CID | 90362386 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1C(C)(C)C12C=Cc1ccccc12 |
| InChI | InChI=1S/C15H16O2/c1-14(2)12(13(16)17-3)15(14)9-8-10-6-4-5-7-11(10)15/h4-9,12H,1-3H3 |
| InChIKey | CKYIIKLSTYYFKM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate?
The IUPAC name of methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate (CID 90362386) is methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate.
What is the SMILES notation for methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate?
The canonical SMILES for methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate is COC(=O)C1C(C)(C)C12C=Cc1ccccc12.
What is the InChIKey of methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate?
The InChIKey is CKYIIKLSTYYFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-14(2)12(13(16)17-3)15(14)9-8-10-6-4-5-7-11(10)15/h4-9,12H,1-3H3.
What are the key properties of methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate?
methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethylspiro[cyclopropane-3,1'-indene]-1-carboxylate is sourced from PubChem (CID 90362386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).