About (1E)-N,3-dihydroxypropanimidoyl iodide
(1E)-N,3-dihydroxypropanimidoyl iodide (PubChem CID 90362404) has the molecular formula C3H6INO2
and a molecular weight of 214.99 g/mol. Its IUPAC name is (1E)-N,3-dihydroxypropanimidoyl iodide.
Molecular Properties
| Compound Name | (1E)-N,3-dihydroxypropanimidoyl iodide |
| PubChem CID | 90362404 |
| Molecular Formula | C3H6INO2 |
| Molecular Weight | 214.99 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | (1E)-N,3-dihydroxypropanimidoyl iodide |
| SMILES | OCC/C(I)=N\O |
| InChI | InChI=1S/C3H6INO2/c4-3(5-7)1-2-6/h6-7H,1-2H2/b5-3+ |
| InChIKey | NYEWPAQVRVWEMS-HWKANZROSA-N |
| XLogP | 0.59 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.99 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N,3-dihydroxypropanimidoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N,3-dihydroxypropanimidoyl iodide?
The IUPAC name of (1E)-N,3-dihydroxypropanimidoyl iodide (CID 90362404) is (1E)-N,3-dihydroxypropanimidoyl iodide.
What is the SMILES notation for (1E)-N,3-dihydroxypropanimidoyl iodide?
The canonical SMILES for (1E)-N,3-dihydroxypropanimidoyl iodide is OCC/C(I)=N\O.
What is the InChIKey of (1E)-N,3-dihydroxypropanimidoyl iodide?
The InChIKey is NYEWPAQVRVWEMS-HWKANZROSA-N. The full InChI is InChI=1S/C3H6INO2/c4-3(5-7)1-2-6/h6-7H,1-2H2/b5-3+.
What are the key properties of (1E)-N,3-dihydroxypropanimidoyl iodide?
(1E)-N,3-dihydroxypropanimidoyl iodide has a molecular weight of 214.99 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N,3-dihydroxypropanimidoyl iodide is sourced from PubChem (CID 90362404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).