C26H31F2N3O4 — CID 90362427
(10S,15R)-4-butoxy-N-[(2,4-difluorophenyl)methyl]-15-methyl-2,5-dioxo-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide (PubChem CID 90362427) has the molecular formula C26H31F2N3O4 and a molecular weight of 487.55 g/mol. Its IUPAC name is (10S,15R)-4-butoxy-N-[(2,4-difluorophenyl)methyl]-15-methyl-2,5-dioxo-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide.
| Compound Name | (10S,15R)-4-butoxy-N-[(2,4-difluorophenyl)methyl]-15-methyl-2,5-dioxo-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 90362427 |
| Molecular Formula | C26H31F2N3O4 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (10S,15R)-4-butoxy-N-[(2,4-difluorophenyl)methyl]-15-methyl-2,5-dioxo-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C[C@@H]1CCCC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C26H31F2N3O4/c1-3-4-11-35-24-22-26(34)31-16(2)7-5-6-8-19(31)14-30(22)15-20(23(24)32)25(33)29-13-17-9-10-18(27)12-21(17)28/h9-10,12,15-16,19H,3-8,11,13-14H2,1-2H3,(H,29,33)/t16-,19+/m1/s1 |
| InChIKey | UZSBSHIXBWIRCG-APWZRJJASA-N |
| XLogP | 4.02 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|