About 3-fluoro-1,2-dihydropyridin-5-amine
3-fluoro-1,2-dihydropyridin-5-amine (PubChem CID 90362436) has the molecular formula C5H7FN2
and a molecular weight of 114.12 g/mol. Its IUPAC name is 3-fluoro-1,2-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 3-fluoro-1,2-dihydropyridin-5-amine |
| PubChem CID | 90362436 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 3-fluoro-1,2-dihydropyridin-5-amine |
| SMILES | NC1=CNCC(F)=C1 |
| InChI | InChI=1S/C5H7FN2/c6-4-1-5(7)3-8-2-4/h1,3,8H,2,7H2 |
| InChIKey | JOENWDGXTUZWMG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,2-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,2-dihydropyridin-5-amine?
The IUPAC name of 3-fluoro-1,2-dihydropyridin-5-amine (CID 90362436) is 3-fluoro-1,2-dihydropyridin-5-amine.
What is the SMILES notation for 3-fluoro-1,2-dihydropyridin-5-amine?
The canonical SMILES for 3-fluoro-1,2-dihydropyridin-5-amine is NC1=CNCC(F)=C1.
What is the InChIKey of 3-fluoro-1,2-dihydropyridin-5-amine?
The InChIKey is JOENWDGXTUZWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2/c6-4-1-5(7)3-8-2-4/h1,3,8H,2,7H2.
What are the key properties of 3-fluoro-1,2-dihydropyridin-5-amine?
3-fluoro-1,2-dihydropyridin-5-amine has a molecular weight of 114.12 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,2-dihydropyridin-5-amine is sourced from PubChem (CID 90362436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).