C15H10F4N4O4 — CID 90362502
2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 90362502) has the molecular formula C15H10F4N4O4 and a molecular weight of 386.26 g/mol. Its IUPAC name is 2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | 2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 90362502 |
| Molecular Formula | C15H10F4N4O4 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | C=C1C=CC(=O)N1COCCOC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C15H10F4N4O4/c1-7-2-3-8(24)23(7)6-26-4-5-27-15(25)9-10(16)12(18)14(21-22-20)13(19)11(9)17/h2-3H,1,4-6H2 |
| InChIKey | QAHDBGVGWBZEHG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|