C30H14F4N2S — CID 90362588
2-phenyl-5-(2,3,5,6-tetrafluoro-4-pyren-2-ylphenyl)-1,3,4-thiadiazole (PubChem CID 90362588) has the molecular formula C30H14F4N2S and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-phenyl-5-(2,3,5,6-tetrafluoro-4-pyren-2-ylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-phenyl-5-(2,3,5,6-tetrafluoro-4-pyren-2-ylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 90362588 |
| Molecular Formula | C30H14F4N2S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 2-phenyl-5-(2,3,5,6-tetrafluoro-4-pyren-2-ylphenyl)-1,3,4-thiadiazole |
| SMILES | Fc1c(F)c(-c2nnc(-c3ccccc3)s2)c(F)c(F)c1-c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C30H14F4N2S/c31-25-23(20-13-18-11-9-15-7-4-8-16-10-12-19(14-20)22(18)21(15)16)26(32)28(34)24(27(25)33)30-36-35-29(37-30)17-5-2-1-3-6-17/h1-14H |
| InChIKey | WGJRHIPKBKQQJQ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|