C23H29N3O3 — CID 90362712
3-[[4-[3-oxo-3-[(4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]propyl]phenyl]methylamino]propanoic acid (PubChem CID 90362712) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-[[4-[3-oxo-3-[(4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]propyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[3-oxo-3-[(4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]propyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 90362712 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 3-[[4-[3-oxo-3-[(4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]propyl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1nn(C(=O)CCc2ccc(CNCCC(=O)O)cc2)c2c1C1[C@H](C2)C1(C)C |
| InChI | InChI=1S/C23H29N3O3/c1-14-21-18(12-17-22(21)23(17,2)3)26(25-14)19(27)9-8-15-4-6-16(7-5-15)13-24-11-10-20(28)29/h4-7,17,22,24H,8-13H2,1-3H3,(H,28,29)/t17-,22?/m0/s1 |
| InChIKey | MBQQHIMNZNLSJH-LBOXEOMUSA-N |
| XLogP | 3.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|