C26H37N3O6 — CID 90363045
tert-butyl N-[1-[2-(7-butoxy-2-oxo-1,5-naphthyridin-1-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]carbamate (PubChem CID 90363045) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(7-butoxy-2-oxo-1,5-naphthyridin-1-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(7-butoxy-2-oxo-1,5-naphthyridin-1-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]carbamate |
|---|---|
| PubChem CID | 90363045 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | tert-butyl N-[1-[2-(7-butoxy-2-oxo-1,5-naphthyridin-1-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]carbamate |
| SMILES | CCCCOc1cnc2ccc(=O)n(CC(O)C34CCC(NC(=O)OC(C)(C)C)(CC3)CO4)c2c1 |
| InChI | InChI=1S/C26H37N3O6/c1-5-6-13-33-18-14-20-19(27-15-18)7-8-22(31)29(20)16-21(30)26-11-9-25(10-12-26,17-34-26)28-23(32)35-24(2,3)4/h7-8,14-15,21,30H,5-6,9-13,16-17H2,1-4H3,(H,28,32) |
| InChIKey | RLHDAMNCSKYYKC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|