C15H13ClN2O2 — CID 90363391
1-(6-chloro-3-pyridinyl)-4-(6-methyl-3-pyridinyl)butane-1,4-dione (PubChem CID 90363391) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-4-(6-methyl-3-pyridinyl)butane-1,4-dione.
| Compound Name | 1-(6-chloro-3-pyridinyl)-4-(6-methyl-3-pyridinyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363391 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-4-(6-methyl-3-pyridinyl)butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)c2ccc(Cl)nc2)cn1 |
| InChI | InChI=1S/C15H13ClN2O2/c1-10-2-3-11(8-17-10)13(19)5-6-14(20)12-4-7-15(16)18-9-12/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | SXDVSINMEMUATD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|