About 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione
1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione (PubChem CID 90363435) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione.
Molecular Properties
| Compound Name | 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione |
| PubChem CID | 90363435 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione |
| SMILES | COc1ncc(C(=O)CCC(=O)c2cnc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C18H20N2O3/c1-11-7-14(9-19-13(11)3)16(21)5-6-17(22)15-8-12(2)18(23-4)20-10-15/h7-10H,5-6H2,1-4H3 |
| InChIKey | LJBPPOSQCCHEHI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione?
The IUPAC name of 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione (CID 90363435) is 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione.
What is the SMILES notation for 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione?
The canonical SMILES for 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione is COc1ncc(C(=O)CCC(=O)c2cnc(C)c(C)c2)cc1C.
What is the InChIKey of 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione?
The InChIKey is LJBPPOSQCCHEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-11-7-14(9-19-13(11)3)16(21)5-6-17(22)15-8-12(2)18(23-4)20-10-15/h7-10H,5-6H2,1-4H3.
What are the key properties of 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione?
1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione has a molecular weight of 312.37 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethyl-3-pyridinyl)-4-(6-methoxy-5-methyl-3-pyridinyl)butane-1,4-dione is sourced from PubChem (CID 90363435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).