C16H12BrClO2 — CID 90363452
1-(3-bromophenyl)-4-(2-chlorophenyl)butane-1,4-dione (PubChem CID 90363452) has the molecular formula C16H12BrClO2 and a molecular weight of 351.63 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4-(2-chlorophenyl)butane-1,4-dione.
| Compound Name | 1-(3-bromophenyl)-4-(2-chlorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363452 |
| Molecular Formula | C16H12BrClO2 |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 1-(3-bromophenyl)-4-(2-chlorophenyl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccc1Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrClO2/c17-12-5-3-4-11(10-12)15(19)8-9-16(20)13-6-1-2-7-14(13)18/h1-7,10H,8-9H2 |
| InChIKey | NSEGGSMPYVPJPI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |