C19H11F7O3S — CID 90363479
1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione (PubChem CID 90363479) has the molecular formula C19H11F7O3S and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione.
| Compound Name | 1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 90363479 |
| Molecular Formula | C19H11F7O3S |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)-4-[4-(trifluoromethyl)phenyl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OC(F)(F)C(F)(F)S2)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H11F7O3S/c20-17(21,22)12-4-1-10(2-5-12)13(27)6-7-14(28)11-3-8-16-15(9-11)29-18(23,24)19(25,26)30-16/h1-5,8-9H,6-7H2 |
| InChIKey | UGINVVPRQOJQKC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|