C17H11F4NO3S — CID 90363485
1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione (PubChem CID 90363485) has the molecular formula C17H11F4NO3S and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione.
| Compound Name | 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363485 |
| Molecular Formula | C17H11F4NO3S |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 1-pyridin-2-yl-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccn1)c1ccc2c(c1)OC(F)(F)C(F)(F)S2 |
| InChI | InChI=1S/C17H11F4NO3S/c18-16(19)17(20,21)26-15-7-4-10(9-14(15)25-16)12(23)5-6-13(24)11-3-1-2-8-22-11/h1-4,7-9H,5-6H2 |
| InChIKey | WBEMMTDHPBDQDK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|