C19H16O4 — CID 90363608
1-(1-benzofuran-5-yl)-4-(3-methoxyphenyl)butane-1,4-dione (PubChem CID 90363608) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)-4-(3-methoxyphenyl)butane-1,4-dione.
| Compound Name | 1-(1-benzofuran-5-yl)-4-(3-methoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363608 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(1-benzofuran-5-yl)-4-(3-methoxyphenyl)butane-1,4-dione |
| SMILES | COc1cccc(C(=O)CCC(=O)c2ccc3occc3c2)c1 |
| InChI | InChI=1S/C19H16O4/c1-22-16-4-2-3-13(12-16)17(20)6-7-18(21)14-5-8-19-15(11-14)9-10-23-19/h2-5,8-12H,6-7H2,1H3 |
| InChIKey | YKDDOSGXDIKUKI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |