C18H13F4NO5 — CID 90363858
1-(3-methoxy-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione (PubChem CID 90363858) has the molecular formula C18H13F4NO5 and a molecular weight of 399.30 g/mol. Its IUPAC name is 1-(3-methoxy-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione.
| Compound Name | 1-(3-methoxy-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363858 |
| Molecular Formula | C18H13F4NO5 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 1-(3-methoxy-2-pyridinyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
| SMILES | COc1cccnc1C(=O)CCC(=O)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C18H13F4NO5/c1-26-14-3-2-8-23-16(14)12(25)6-5-11(24)10-4-7-13-15(9-10)28-18(21,22)17(19,20)27-13/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | XALKZMXXGGPYAL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|