C18H10F7NO4 — CID 90363859
1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione (PubChem CID 90363859) has the molecular formula C18H10F7NO4 and a molecular weight of 437.27 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione.
| Compound Name | 1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione |
|---|---|
| PubChem CID | 90363859 |
| Molecular Formula | C18H10F7NO4 |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ncccc1C(F)(F)F)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C18H10F7NO4/c19-16(20,21)10-2-1-7-26-15(10)12(28)5-4-11(27)9-3-6-13-14(8-9)30-18(24,25)17(22,23)29-13/h1-3,6-8H,4-5H2 |
| InChIKey | AMBVHOKWZDZHRZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|