About 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine
2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine (PubChem CID 90364017) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine |
| PubChem CID | 90364017 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine |
| SMILES | CC1=Nc2nn(C)cc2CC1 |
| InChI | InChI=1S/C8H11N3/c1-6-3-4-7-5-11(2)10-8(7)9-6/h5H,3-4H2,1-2H3 |
| InChIKey | SLDPSUKRCHNWGQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine?
The IUPAC name of 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine (CID 90364017) is 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine.
What is the SMILES notation for 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine?
The canonical SMILES for 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine is CC1=Nc2nn(C)cc2CC1.
What is the InChIKey of 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine?
The InChIKey is SLDPSUKRCHNWGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6-3-4-7-5-11(2)10-8(7)9-6/h5H,3-4H2,1-2H3.
What are the key properties of 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine?
2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine has a molecular weight of 149.20 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4,5-dihydropyrazolo[3,4-b]pyridine is sourced from PubChem (CID 90364017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).