About 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine
2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine (PubChem CID 90364026) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine |
| PubChem CID | 90364026 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine |
| SMILES | Cc1cc2c(s1)N=CC(C)C2 |
| InChI | InChI=1S/C9H11NS/c1-6-3-8-4-7(2)11-9(8)10-5-6/h4-6H,3H2,1-2H3 |
| InChIKey | MXDOFEJLCHABGN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine?
The IUPAC name of 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine (CID 90364026) is 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine.
What is the SMILES notation for 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine?
The canonical SMILES for 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine is Cc1cc2c(s1)N=CC(C)C2.
What is the InChIKey of 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine?
The InChIKey is MXDOFEJLCHABGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-6-3-8-4-7(2)11-9(8)10-5-6/h4-6H,3H2,1-2H3.
What are the key properties of 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine?
2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine has a molecular weight of 165.26 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4,5-dihydrothieno[2,3-b]pyridine is sourced from PubChem (CID 90364026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).