C42H39IN8O7S2 — CID 90364054
5-[6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 90364054) has the molecular formula C42H39IN8O7S2 and a molecular weight of 958.86 g/mol. Its IUPAC name is 5-[6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 90364054 |
| Molecular Formula | C42H39IN8O7S2 |
| Molecular Weight | 958.86 g/mol |
| Exact Mass | 958.14 |
| IUPAC Name | 5-[6-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylamino]hexylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCNCCCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C42H39IN8O7S2/c43-30-19-33-34(57-22-56-33)20-35(30)60-42-50-37-38(44)47-21-48-39(37)51(42)15-5-13-45-12-3-1-2-4-14-46-41(59)49-23-6-9-26(29(16-23)40(54)55)36-27-10-7-24(52)17-31(27)58-32-18-25(53)8-11-28(32)36/h6-11,16-21,45,52H,1-5,12-15,22H2,(H,54,55)(H2,44,47,48)(H2,46,49,59) |
| InChIKey | FCBSMSFSXCWAAY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 211.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.86 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|