C41H38N8O7S2 — CID 90364058
5-[[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 90364058) has the molecular formula C41H38N8O7S2 and a molecular weight of 818.94 g/mol. Its IUPAC name is 5-[[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 90364058 |
| Molecular Formula | C41H38N8O7S2 |
| Molecular Weight | 818.94 g/mol |
| Exact Mass | 818.23 |
| IUPAC Name | 5-[[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl-propan-2-ylcarbamothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)N(CCCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21)C(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C41H38N8O7S2/c1-21(2)48(12-5-13-49-38-36(37(42)43-19-44-38)46-41(49)58-34-18-33-32(54-20-55-33)17-29(34)47(3)4)40(57)45-22-6-9-25(28(14-22)39(52)53)35-26-10-7-23(50)15-30(26)56-31-16-24(51)8-11-27(31)35/h6-11,14-19,21,50H,5,12-13,20H2,1-4H3,(H,45,57)(H,52,53)(H2,42,43,44) |
| InChIKey | LIKDJSREHNXHDX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.94 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|