C37H34N10O3S2 — CID 90364081
(E)-N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 90364081) has the molecular formula C37H34N10O3S2 and a molecular weight of 730.88 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90364081 |
| Molecular Formula | C37H34N10O3S2 |
| Molecular Weight | 730.88 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | (E)-N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc3cc(/C=C(\C#N)C(=O)NCCCn4c(Sc5cc6c(cc5-c5nccs5)OCO6)nc5c(N)ncnc54)ccc3c2)CC1 |
| InChI | InChI=1S/C37H34N10O3S2/c1-45-10-12-46(13-11-45)27-6-5-24-15-23(3-4-25(24)17-27)16-26(20-38)35(48)40-7-2-9-47-34-32(33(39)42-21-43-34)44-37(47)52-31-19-30-29(49-22-50-30)18-28(31)36-41-8-14-51-36/h3-6,8,14-19,21H,2,7,9-13,22H2,1H3,(H,40,48)(H2,39,42,43)/b26-16+ |
| InChIKey | IUIXUHJXLNSCBV-WGOQTCKBSA-N |
| XLogP | 5.43 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|