C35H35N9O3S — CID 90364084
(E)-N-[3-[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 90364084) has the molecular formula C35H35N9O3S and a molecular weight of 661.79 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90364084 |
| Molecular Formula | C35H35N9O3S |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | (E)-N-[3-[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(=O)/C(C#N)=C/c1ccc3cc(N4CCN(C)CC4)ccc3c1)OCO2 |
| InChI | InChI=1S/C35H35N9O3S/c1-22-14-28-29(47-21-46-28)18-30(22)48-35-41-31-32(37)39-20-40-33(31)44(35)9-3-8-38-34(45)26(19-36)16-23-4-5-25-17-27(7-6-24(25)15-23)43-12-10-42(2)11-13-43/h4-7,14-18,20H,3,8-13,21H2,1-2H3,(H,38,45)(H2,37,39,40)/b26-16+ |
| InChIKey | OIGSQCXQYARTCO-WGOQTCKBSA-N |
| XLogP | 4.62 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|