C36H38N10O3S — CID 90364087
(E)-N-[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 90364087) has the molecular formula C36H38N10O3S and a molecular weight of 690.83 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90364087 |
| Molecular Formula | C36H38N10O3S |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | (E)-N-[3-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc3cc(/C=C(\C#N)C(=O)NCCCn4c(Sc5cc6c(cc5N(C)C)OCO6)nc5c(N)ncnc54)ccc3c2)CC1 |
| InChI | InChI=1S/C36H38N10O3S/c1-43(2)28-18-29-30(49-22-48-29)19-31(28)50-36-42-32-33(38)40-21-41-34(32)46(36)10-4-9-39-35(47)26(20-37)16-23-5-6-25-17-27(8-7-24(25)15-23)45-13-11-44(3)12-14-45/h5-8,15-19,21H,4,9-14,22H2,1-3H3,(H,39,47)(H2,38,40,41)/b26-16+ |
| InChIKey | YYLHKUNDBAVZQH-WGOQTCKBSA-N |
| XLogP | 4.37 |
| TPSA | 150.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|