About (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine
(3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine (PubChem CID 90364219) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine.
Molecular Properties
| Compound Name | (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine |
| PubChem CID | 90364219 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine |
| SMILES | CC(C)[C@@H]1CS(=O)(=O)CC[C@@H]1N |
| InChI | InChI=1S/C8H17NO2S/c1-6(2)7-5-12(10,11)4-3-8(7)9/h6-8H,3-5,9H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | DNADSIIERQQCQM-YUMQZZPRSA-N |
| XLogP | 0.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine?
The IUPAC name of (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine (CID 90364219) is (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine.
What is the SMILES notation for (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine?
The canonical SMILES for (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine is CC(C)[C@@H]1CS(=O)(=O)CC[C@@H]1N.
What is the InChIKey of (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine?
The InChIKey is DNADSIIERQQCQM-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-6(2)7-5-12(10,11)4-3-8(7)9/h6-8H,3-5,9H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine?
(3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine has a molecular weight of 191.30 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1,1-dioxo-3-propan-2-ylthian-4-amine is sourced from PubChem (CID 90364219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).