About 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline
2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline (PubChem CID 90364344) has the molecular formula C19H25N3O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline.
Molecular Properties
| Compound Name | 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline |
| PubChem CID | 90364344 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline |
| SMILES | Cc1cc(N)c(/N=N/c2cc(S(=O)(=O)C(C)C)c(C)cc2C)cc1C |
| InChI | InChI=1S/C19H25N3O2S/c1-11(2)25(23,24)19-10-17(14(5)7-15(19)6)21-22-18-9-13(4)12(3)8-16(18)20/h7-11H,20H2,1-6H3/b22-21+ |
| InChIKey | BYGUNWXJNZXWOG-QURGRASLSA-N |
| XLogP | 5.10 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline?
The IUPAC name of 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline (CID 90364344) is 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline.
What is the SMILES notation for 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline?
The canonical SMILES for 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline is Cc1cc(N)c(/N=N/c2cc(S(=O)(=O)C(C)C)c(C)cc2C)cc1C.
What is the InChIKey of 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline?
The InChIKey is BYGUNWXJNZXWOG-QURGRASLSA-N. The full InChI is InChI=1S/C19H25N3O2S/c1-11(2)25(23,24)19-10-17(14(5)7-15(19)6)21-22-18-9-13(4)12(3)8-16(18)20/h7-11H,20H2,1-6H3/b22-21+.
What are the key properties of 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline?
2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline has a molecular weight of 359.50 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethyl-5-propan-2-ylsulfonylphenyl)diazenyl]-4,5-dimethylaniline is sourced from PubChem (CID 90364344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).