C34H31ClN6O5 — CID 90365258
2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-[2-[2-(6,7-dihydroxynaphthalen-2-yl)ethylamino]-2-oxoethyl]acetamide (PubChem CID 90365258) has the molecular formula C34H31ClN6O5 and a molecular weight of 639.11 g/mol. Its IUPAC name is 2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-[2-[2-(6,7-dihydroxynaphthalen-2-yl)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-[2-[2-(6,7-dihydroxynaphthalen-2-yl)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 90365258 |
| Molecular Formula | C34H31ClN6O5 |
| Molecular Weight | 639.11 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-[2-[2-(6,7-dihydroxynaphthalen-2-yl)ethylamino]-2-oxoethyl]acetamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCC(=O)NCCc1ccc3cc(O)c(O)cc3c1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C34H31ClN6O5/c1-19-39-40-34-27(38-33(21-5-7-24(35)8-6-21)26-16-25(46-2)9-10-28(26)41(19)34)17-31(44)37-18-32(45)36-12-11-20-3-4-22-14-29(42)30(43)15-23(22)13-20/h3-10,13-16,27,42-43H,11-12,17-18H2,1-2H3,(H,36,45)(H,37,44)/t27-/m0/s1 |
| InChIKey | BDFBZFJIFFXFKJ-MHZLTWQESA-N |
| XLogP | 4.56 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.11 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|