About 2,7-dimethoxy-8-methyl-1,5-naphthyridine
2,7-dimethoxy-8-methyl-1,5-naphthyridine (PubChem CID 90365423) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2,7-dimethoxy-8-methyl-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2,7-dimethoxy-8-methyl-1,5-naphthyridine |
| PubChem CID | 90365423 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2,7-dimethoxy-8-methyl-1,5-naphthyridine |
| SMILES | COc1ccc2ncc(OC)c(C)c2n1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-9(14-2)6-12-8-4-5-10(15-3)13-11(7)8/h4-6H,1-3H3 |
| InChIKey | DMRHPUQKGPMCRT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-dimethoxy-8-methyl-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethoxy-8-methyl-1,5-naphthyridine?
The IUPAC name of 2,7-dimethoxy-8-methyl-1,5-naphthyridine (CID 90365423) is 2,7-dimethoxy-8-methyl-1,5-naphthyridine.
What is the SMILES notation for 2,7-dimethoxy-8-methyl-1,5-naphthyridine?
The canonical SMILES for 2,7-dimethoxy-8-methyl-1,5-naphthyridine is COc1ccc2ncc(OC)c(C)c2n1.
What is the InChIKey of 2,7-dimethoxy-8-methyl-1,5-naphthyridine?
The InChIKey is DMRHPUQKGPMCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-7-9(14-2)6-12-8-4-5-10(15-3)13-11(7)8/h4-6H,1-3H3.
What are the key properties of 2,7-dimethoxy-8-methyl-1,5-naphthyridine?
2,7-dimethoxy-8-methyl-1,5-naphthyridine has a molecular weight of 204.23 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethoxy-8-methyl-1,5-naphthyridine is sourced from PubChem (CID 90365423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).