About 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane]
2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] (PubChem CID 90365446) has the molecular formula C23H28S
and a molecular weight of 336.54 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane].
Molecular Properties
| Compound Name | 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] |
| PubChem CID | 90365446 |
| Molecular Formula | C23H28S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] |
| SMILES | CC(C)c1ccc2c(c1)C1(CCCCS1)c1cc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C23H28S/c1-15(2)17-7-9-19-20-10-8-18(16(3)4)14-22(20)23(21(19)13-17)11-5-6-12-24-23/h7-10,13-16H,5-6,11-12H2,1-4H3 |
| InChIKey | IFXIZHUUAUXTAL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane]?
The IUPAC name of 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] (CID 90365446) is 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane].
What is the SMILES notation for 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane]?
The canonical SMILES for 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] is CC(C)c1ccc2c(c1)C1(CCCCS1)c1cc(C(C)C)ccc1-2.
What is the InChIKey of 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane]?
The InChIKey is IFXIZHUUAUXTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28S/c1-15(2)17-7-9-19-20-10-8-18(16(3)4)14-22(20)23(21(19)13-17)11-5-6-12-24-23/h7-10,13-16H,5-6,11-12H2,1-4H3.
What are the key properties of 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane]?
2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] has a molecular weight of 336.54 g/mol, XLogP of 7.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-di(propan-2-yl)spiro[fluorene-9,2'-thiane] is sourced from PubChem (CID 90365446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).