C11H16O — CID 90365456
(2R,3S,6S)-2-ethyl-3-methyl-6-prop-1-ynyl-3,6-dihydro-2H-pyran (PubChem CID 90365456) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (2R,3S,6S)-2-ethyl-3-methyl-6-prop-1-ynyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6S)-2-ethyl-3-methyl-6-prop-1-ynyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 90365456 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (2R,3S,6S)-2-ethyl-3-methyl-6-prop-1-ynyl-3,6-dihydro-2H-pyran |
| SMILES | CC#C[C@@H]1C=C[C@H](C)[C@@H](CC)O1 |
| InChI | InChI=1S/C11H16O/c1-4-6-10-8-7-9(3)11(5-2)12-10/h7-11H,5H2,1-3H3/t9-,10+,11+/m0/s1 |
| InChIKey | DZUKQYAKOALRJX-HBNTYKKESA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|