C19H36O3Si — CID 90365476
[(2R,3S,4R,5S,6S)-6-ethynyl-4,5-dimethyl-3-tri(propan-2-yl)silyloxyoxan-2-yl]methanol (PubChem CID 90365476) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-6-ethynyl-4,5-dimethyl-3-tri(propan-2-yl)silyloxyoxan-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5S,6S)-6-ethynyl-4,5-dimethyl-3-tri(propan-2-yl)silyloxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 90365476 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-6-ethynyl-4,5-dimethyl-3-tri(propan-2-yl)silyloxyoxan-2-yl]methanol |
| SMILES | C#C[C@H]1O[C@H](CO)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C1C |
| InChI | InChI=1S/C19H36O3Si/c1-10-17-15(8)16(9)19(18(11-20)21-17)22-23(12(2)3,13(4)5)14(6)7/h1,12-20H,11H2,2-9H3/t15?,16-,17-,18-,19+/m1/s1 |
| InChIKey | XYAZASZEWBZWAA-MFXPGESHSA-N |
| XLogP | 4.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|