C18H36O2Si — CID 90365491
tert-butyl-[(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl]oxy-dimethylsilane (PubChem CID 90365491) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 90365491 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl-[(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H]1O[C@H](CC)[C@@H](C)[C@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-10-12-16-17(20-21(8,9)18(5,6)7)14(4)13(3)15(11-2)19-16/h10,13-17H,1,11-12H2,2-9H3/t13-,14-,15+,16+,17-/m0/s1 |
| InChIKey | LPHURUQEWGWPLT-SIRPWMCASA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|