C14H24O3 — CID 90365492
[(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl] acetate (PubChem CID 90365492) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 90365492 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-6-ethyl-4,5-dimethyl-2-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CC[C@H]1O[C@H](CC)[C@@H](C)[C@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H24O3/c1-6-8-13-14(16-11(5)15)10(4)9(3)12(7-2)17-13/h6,9-10,12-14H,1,7-8H2,2-5H3/t9-,10-,12+,13+,14-/m0/s1 |
| InChIKey | KENPVSUINAFUPC-YRASXDPISA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|