C29H32N6O3S — CID 90366196
(1R,2S,3R,5R)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-[(2-phenylcyclopropyl)amino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 90366196) has the molecular formula C29H32N6O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-[(2-phenylcyclopropyl)amino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-[(2-phenylcyclopropyl)amino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90366196 |
| Molecular Formula | C29H32N6O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-[(2-phenylcyclopropyl)amino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NC2CC2c2ccccc2)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2c(C3CC3)nccc2s1 |
| InChI | InChI=1S/C29H32N6O3S/c1-14-22(28-34-24-21(39-28)9-10-30-23(24)16-7-8-16)27(32-20-11-17(13-36)25(37)26(20)38)35-29(31-14)33-19-12-18(19)15-5-3-2-4-6-15/h2-6,9-10,16-20,25-26,36-38H,7-8,11-13H2,1H3,(H2,31,32,33,35)/t17-,18?,19?,20-,25-,26+/m1/s1 |
| InChIKey | OJAREOMXIBGRHJ-GYYXGNGBSA-N |
| XLogP | 3.82 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |