C22H27F3N6O4S — CID 90366245
(1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 90366245) has the molecular formula C22H27F3N6O4S and a molecular weight of 528.56 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90366245 |
| Molecular Formula | C22H27F3N6O4S |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCCOCC(F)(F)F)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C22H27F3N6O4S/c1-10-15(20-30-16-11(2)26-4-3-14(16)36-20)19(29-13-7-12(8-32)17(33)18(13)34)31-21(28-10)27-5-6-35-9-22(23,24)25/h3-4,12-13,17-18,32-34H,5-9H2,1-2H3,(H2,27,28,29,31)/t12-,13-,17-,18+/m1/s1 |
| InChIKey | VUXIFXCCTRIODL-HLNSBACISA-N |
| XLogP | 2.27 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|