C23H31ClN6O4S — CID 90366363
(1R,2S,3R,5S)-3-[[2-[(1-chloro-3-hydroxypropan-2-yl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol (PubChem CID 90366363) has the molecular formula C23H31ClN6O4S and a molecular weight of 523.06 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[[2-[(1-chloro-3-hydroxypropan-2-yl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[[2-[(1-chloro-3-hydroxypropan-2-yl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90366363 |
| Molecular Formula | C23H31ClN6O4S |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (1R,2S,3R,5S)-3-[[2-[(1-chloro-3-hydroxypropan-2-yl)amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NC(CO)CCl)nc(N[C@@H]2C[C@H](C(C)(C)O)[C@@H](O)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C23H31ClN6O4S/c1-10-16(21-29-17-11(2)25-6-5-15(17)35-21)20(30-22(26-10)27-12(8-24)9-31)28-14-7-13(23(3,4)34)18(32)19(14)33/h5-6,12-14,18-19,31-34H,7-9H2,1-4H3,(H2,26,27,28,30)/t12?,13-,14+,18+,19-/m0/s1 |
| InChIKey | WXUMRPUEDIAYDR-NJYJKMNUSA-N |
| XLogP | 2.07 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|